C12H17NO3 — CID 43163025
2-cyclopropyl-2-[[(2E,4E)-hexa-2,4-dienoyl]amino]propanoic acid (PubChem CID 43163025) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 2-cyclopropyl-2-[[(2E,4E)-hexa-2,4-dienoyl]amino]propanoic acid.
| Compound Name | 2-cyclopropyl-2-[[(2E,4E)-hexa-2,4-dienoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 43163025 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 2-cyclopropyl-2-[[(2E,4E)-hexa-2,4-dienoyl]amino]propanoic acid |
| SMILES | C/C=C/C=C/C(=O)NC(C)(C(=O)O)C1CC1 |
| InChI | InChI=1S/C12H17NO3/c1-3-4-5-6-10(14)13-12(2,11(15)16)9-7-8-9/h3-6,9H,7-8H2,1-2H3,(H,13,14)(H,15,16)/b4-3+,6-5+ |
| InChIKey | WZGSHFFIGXBEPU-VNKDHWASSA-N |
| XLogP | 1.49 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|