About 4-amino-2-(1,1-dioxothiolan-3-yl)-5-ethyl-1-methylpyrazol-3-one
4-amino-2-(1,1-dioxothiolan-3-yl)-5-ethyl-1-methylpyrazol-3-one (PubChem CID 43163601) has the molecular formula C10H17N3O3S
and a molecular weight of 259.33 g/mol. Its IUPAC name is 4-amino-2-(1,1-dioxothiolan-3-yl)-5-ethyl-1-methylpyrazol-3-one.
Molecular Properties
| Compound Name | 4-amino-2-(1,1-dioxothiolan-3-yl)-5-ethyl-1-methylpyrazol-3-one |
| PubChem CID | 43163601 |
| Molecular Formula | C10H17N3O3S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 4-amino-2-(1,1-dioxothiolan-3-yl)-5-ethyl-1-methylpyrazol-3-one |
| SMILES | CCc1c(N)c(=O)n(C2CCS(=O)(=O)C2)n1C |
| InChI | InChI=1S/C10H17N3O3S/c1-3-8-9(11)10(14)13(12(8)2)7-4-5-17(15,16)6-7/h7H,3-6,11H2,1-2H3 |
| InChIKey | HGGLOKQYKFJBMI-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-amino-2-(1,1-dioxothiolan-3-yl)-5-ethyl-1-methylpyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-(1,1-dioxothiolan-3-yl)-5-ethyl-1-methylpyrazol-3-one?
The IUPAC name of 4-amino-2-(1,1-dioxothiolan-3-yl)-5-ethyl-1-methylpyrazol-3-one (CID 43163601) is 4-amino-2-(1,1-dioxothiolan-3-yl)-5-ethyl-1-methylpyrazol-3-one.
What is the SMILES notation for 4-amino-2-(1,1-dioxothiolan-3-yl)-5-ethyl-1-methylpyrazol-3-one?
The canonical SMILES for 4-amino-2-(1,1-dioxothiolan-3-yl)-5-ethyl-1-methylpyrazol-3-one is CCc1c(N)c(=O)n(C2CCS(=O)(=O)C2)n1C.
What is the InChIKey of 4-amino-2-(1,1-dioxothiolan-3-yl)-5-ethyl-1-methylpyrazol-3-one?
The InChIKey is HGGLOKQYKFJBMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O3S/c1-3-8-9(11)10(14)13(12(8)2)7-4-5-17(15,16)6-7/h7H,3-6,11H2,1-2H3.
What are the key properties of 4-amino-2-(1,1-dioxothiolan-3-yl)-5-ethyl-1-methylpyrazol-3-one?
4-amino-2-(1,1-dioxothiolan-3-yl)-5-ethyl-1-methylpyrazol-3-one has a molecular weight of 259.33 g/mol, XLogP of -0.31, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-(1,1-dioxothiolan-3-yl)-5-ethyl-1-methylpyrazol-3-one is sourced from PubChem (CID 43163601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).