About 4-amino-1,2-dimethyl-5-propan-2-ylpyrazol-3-one
4-amino-1,2-dimethyl-5-propan-2-ylpyrazol-3-one (PubChem CID 43163631) has the molecular formula C8H15N3O
and a molecular weight of 169.23 g/mol. Its IUPAC name is 4-amino-1,2-dimethyl-5-propan-2-ylpyrazol-3-one.
Molecular Properties
| Compound Name | 4-amino-1,2-dimethyl-5-propan-2-ylpyrazol-3-one |
| PubChem CID | 43163631 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | 4-amino-1,2-dimethyl-5-propan-2-ylpyrazol-3-one |
| SMILES | CC(C)c1c(N)c(=O)n(C)n1C |
| InChI | InChI=1S/C8H15N3O/c1-5(2)7-6(9)8(12)11(4)10(7)3/h5H,9H2,1-4H3 |
| InChIKey | RXPAVBOBZKLTHA-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-amino-1,2-dimethyl-5-propan-2-ylpyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1,2-dimethyl-5-propan-2-ylpyrazol-3-one?
The IUPAC name of 4-amino-1,2-dimethyl-5-propan-2-ylpyrazol-3-one (CID 43163631) is 4-amino-1,2-dimethyl-5-propan-2-ylpyrazol-3-one.
What is the SMILES notation for 4-amino-1,2-dimethyl-5-propan-2-ylpyrazol-3-one?
The canonical SMILES for 4-amino-1,2-dimethyl-5-propan-2-ylpyrazol-3-one is CC(C)c1c(N)c(=O)n(C)n1C.
What is the InChIKey of 4-amino-1,2-dimethyl-5-propan-2-ylpyrazol-3-one?
The InChIKey is RXPAVBOBZKLTHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O/c1-5(2)7-6(9)8(12)11(4)10(7)3/h5H,9H2,1-4H3.
What are the key properties of 4-amino-1,2-dimethyl-5-propan-2-ylpyrazol-3-one?
4-amino-1,2-dimethyl-5-propan-2-ylpyrazol-3-one has a molecular weight of 169.23 g/mol, XLogP of 0.43, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1,2-dimethyl-5-propan-2-ylpyrazol-3-one is sourced from PubChem (CID 43163631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).