About 4-amino-5-tert-butyl-1,2-dimethylpyrazol-3-one
4-amino-5-tert-butyl-1,2-dimethylpyrazol-3-one (PubChem CID 43163633) has the molecular formula C9H17N3O
and a molecular weight of 183.25 g/mol. Its IUPAC name is 4-amino-5-tert-butyl-1,2-dimethylpyrazol-3-one.
Molecular Properties
| Compound Name | 4-amino-5-tert-butyl-1,2-dimethylpyrazol-3-one |
| PubChem CID | 43163633 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 4-amino-5-tert-butyl-1,2-dimethylpyrazol-3-one |
| SMILES | Cn1c(C(C)(C)C)c(N)c(=O)n1C |
| InChI | InChI=1S/C9H17N3O/c1-9(2,3)7-6(10)8(13)12(5)11(7)4/h10H2,1-5H3 |
| InChIKey | VWHHONQLSLKUML-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-amino-5-tert-butyl-1,2-dimethylpyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-5-tert-butyl-1,2-dimethylpyrazol-3-one?
The IUPAC name of 4-amino-5-tert-butyl-1,2-dimethylpyrazol-3-one (CID 43163633) is 4-amino-5-tert-butyl-1,2-dimethylpyrazol-3-one.
What is the SMILES notation for 4-amino-5-tert-butyl-1,2-dimethylpyrazol-3-one?
The canonical SMILES for 4-amino-5-tert-butyl-1,2-dimethylpyrazol-3-one is Cn1c(C(C)(C)C)c(N)c(=O)n1C.
What is the InChIKey of 4-amino-5-tert-butyl-1,2-dimethylpyrazol-3-one?
The InChIKey is VWHHONQLSLKUML-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O/c1-9(2,3)7-6(10)8(13)12(5)11(7)4/h10H2,1-5H3.
What are the key properties of 4-amino-5-tert-butyl-1,2-dimethylpyrazol-3-one?
4-amino-5-tert-butyl-1,2-dimethylpyrazol-3-one has a molecular weight of 183.25 g/mol, XLogP of 0.60, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-5-tert-butyl-1,2-dimethylpyrazol-3-one is sourced from PubChem (CID 43163633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).