About N-ethyl-2,2-difluoroethanamine
N-ethyl-2,2-difluoroethanamine (PubChem CID 43163694) has the molecular formula C4H9F2N
and a molecular weight of 109.12 g/mol. Its IUPAC name is N-ethyl-2,2-difluoroethanamine.
Molecular Properties
| Compound Name | N-ethyl-2,2-difluoroethanamine |
| PubChem CID | 43163694 |
| Molecular Formula | C4H9F2N |
| Molecular Weight | 109.12 g/mol |
| Exact Mass | 109.07 |
| IUPAC Name | N-ethyl-2,2-difluoroethanamine |
| SMILES | CCNCC(F)F |
| InChI | InChI=1S/C4H9F2N/c1-2-7-3-4(5)6/h4,7H,2-3H2,1H3 |
| InChIKey | UKCJPWSGPORHQG-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.12 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-ethyl-2,2-difluoroethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2,2-difluoroethanamine?
The IUPAC name of N-ethyl-2,2-difluoroethanamine (CID 43163694) is N-ethyl-2,2-difluoroethanamine.
What is the SMILES notation for N-ethyl-2,2-difluoroethanamine?
The canonical SMILES for N-ethyl-2,2-difluoroethanamine is CCNCC(F)F.
What is the InChIKey of N-ethyl-2,2-difluoroethanamine?
The InChIKey is UKCJPWSGPORHQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9F2N/c1-2-7-3-4(5)6/h4,7H,2-3H2,1H3.
What are the key properties of N-ethyl-2,2-difluoroethanamine?
N-ethyl-2,2-difluoroethanamine has a molecular weight of 109.12 g/mol, XLogP of 0.86, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2,2-difluoroethanamine is sourced from PubChem (CID 43163694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).