About 2-hydrazinyl-2-oxo-N,N-dipropylacetamide
2-hydrazinyl-2-oxo-N,N-dipropylacetamide (PubChem CID 43164055) has the molecular formula C8H17N3O2
and a molecular weight of 187.24 g/mol. Its IUPAC name is 2-hydrazinyl-2-oxo-N,N-dipropylacetamide.
Molecular Properties
| Compound Name | 2-hydrazinyl-2-oxo-N,N-dipropylacetamide |
| PubChem CID | 43164055 |
| Molecular Formula | C8H17N3O2 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.13 |
| IUPAC Name | 2-hydrazinyl-2-oxo-N,N-dipropylacetamide |
| SMILES | CCCN(CCC)C(=O)C(=O)NN |
| InChI | InChI=1S/C8H17N3O2/c1-3-5-11(6-4-2)8(13)7(12)10-9/h3-6,9H2,1-2H3,(H,10,12) |
| InChIKey | WFJSVEOULPTZOE-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hydrazinyl-2-oxo-N,N-dipropylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydrazinyl-2-oxo-N,N-dipropylacetamide?
The IUPAC name of 2-hydrazinyl-2-oxo-N,N-dipropylacetamide (CID 43164055) is 2-hydrazinyl-2-oxo-N,N-dipropylacetamide.
What is the SMILES notation for 2-hydrazinyl-2-oxo-N,N-dipropylacetamide?
The canonical SMILES for 2-hydrazinyl-2-oxo-N,N-dipropylacetamide is CCCN(CCC)C(=O)C(=O)NN.
What is the InChIKey of 2-hydrazinyl-2-oxo-N,N-dipropylacetamide?
The InChIKey is WFJSVEOULPTZOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3O2/c1-3-5-11(6-4-2)8(13)7(12)10-9/h3-6,9H2,1-2H3,(H,10,12).
What are the key properties of 2-hydrazinyl-2-oxo-N,N-dipropylacetamide?
2-hydrazinyl-2-oxo-N,N-dipropylacetamide has a molecular weight of 187.24 g/mol, XLogP of -0.38, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydrazinyl-2-oxo-N,N-dipropylacetamide is sourced from PubChem (CID 43164055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).