About 3-chloro-4-(2,2,2-trifluoroethoxy)benzenesulfonamide
3-chloro-4-(2,2,2-trifluoroethoxy)benzenesulfonamide (PubChem CID 43164463) has the molecular formula C8H7ClF3NO3S
and a molecular weight of 289.66 g/mol. Its IUPAC name is 3-chloro-4-(2,2,2-trifluoroethoxy)benzenesulfonamide.
Molecular Properties
| Compound Name | 3-chloro-4-(2,2,2-trifluoroethoxy)benzenesulfonamide |
| PubChem CID | 43164463 |
| Molecular Formula | C8H7ClF3NO3S |
| Molecular Weight | 289.66 g/mol |
| Exact Mass | 288.98 |
| IUPAC Name | 3-chloro-4-(2,2,2-trifluoroethoxy)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(OCC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C8H7ClF3NO3S/c9-6-3-5(17(13,14)15)1-2-7(6)16-4-8(10,11)12/h1-3H,4H2,(H2,13,14,15) |
| InChIKey | WJPUNXBYQSKUAK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.66 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-chloro-4-(2,2,2-trifluoroethoxy)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-(2,2,2-trifluoroethoxy)benzenesulfonamide?
The IUPAC name of 3-chloro-4-(2,2,2-trifluoroethoxy)benzenesulfonamide (CID 43164463) is 3-chloro-4-(2,2,2-trifluoroethoxy)benzenesulfonamide.
What is the SMILES notation for 3-chloro-4-(2,2,2-trifluoroethoxy)benzenesulfonamide?
The canonical SMILES for 3-chloro-4-(2,2,2-trifluoroethoxy)benzenesulfonamide is NS(=O)(=O)c1ccc(OCC(F)(F)F)c(Cl)c1.
What is the InChIKey of 3-chloro-4-(2,2,2-trifluoroethoxy)benzenesulfonamide?
The InChIKey is WJPUNXBYQSKUAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClF3NO3S/c9-6-3-5(17(13,14)15)1-2-7(6)16-4-8(10,11)12/h1-3H,4H2,(H2,13,14,15).
What are the key properties of 3-chloro-4-(2,2,2-trifluoroethoxy)benzenesulfonamide?
3-chloro-4-(2,2,2-trifluoroethoxy)benzenesulfonamide has a molecular weight of 289.66 g/mol, XLogP of 1.93, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-(2,2,2-trifluoroethoxy)benzenesulfonamide is sourced from PubChem (CID 43164463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).