C7H6F3NO4S2 — CID 43164789
3-(2,2,2-trifluoroethylsulfamoyl)thiophene-2-carboxylic acid (PubChem CID 43164789) has the molecular formula C7H6F3NO4S2 and a molecular weight of 289.26 g/mol. Its IUPAC name is 3-(2,2,2-trifluoroethylsulfamoyl)thiophene-2-carboxylic acid.
| Compound Name | 3-(2,2,2-trifluoroethylsulfamoyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 43164789 |
| Molecular Formula | C7H6F3NO4S2 |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 288.97 |
| IUPAC Name | 3-(2,2,2-trifluoroethylsulfamoyl)thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sccc1S(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C7H6F3NO4S2/c8-7(9,10)3-11-17(14,15)4-1-2-16-5(4)6(12)13/h1-2,11H,3H2,(H,12,13) |
| InChIKey | XZXBODQKESSHNN-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |