About 1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-(propylamino)propan-2-ol
1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-(propylamino)propan-2-ol (PubChem CID 43166380) has the molecular formula C9H18N4OS
and a molecular weight of 230.34 g/mol. Its IUPAC name is 1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-(propylamino)propan-2-ol.
Molecular Properties
| Compound Name | 1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-(propylamino)propan-2-ol |
| PubChem CID | 43166380 |
| Molecular Formula | C9H18N4OS |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-(propylamino)propan-2-ol |
| SMILES | CCCNCC(O)CSc1nncn1C |
| InChI | InChI=1S/C9H18N4OS/c1-3-4-10-5-8(14)6-15-9-12-11-7-13(9)2/h7-8,10,14H,3-6H2,1-2H3 |
| InChIKey | KHJBMFWOCLKPJE-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-(propylamino)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-(propylamino)propan-2-ol?
The IUPAC name of 1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-(propylamino)propan-2-ol (CID 43166380) is 1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-(propylamino)propan-2-ol.
What is the SMILES notation for 1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-(propylamino)propan-2-ol?
The canonical SMILES for 1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-(propylamino)propan-2-ol is CCCNCC(O)CSc1nncn1C.
What is the InChIKey of 1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-(propylamino)propan-2-ol?
The InChIKey is KHJBMFWOCLKPJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N4OS/c1-3-4-10-5-8(14)6-15-9-12-11-7-13(9)2/h7-8,10,14H,3-6H2,1-2H3.
What are the key properties of 1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-(propylamino)propan-2-ol?
1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-(propylamino)propan-2-ol has a molecular weight of 230.34 g/mol, XLogP of 0.27, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]-3-(propylamino)propan-2-ol is sourced from PubChem (CID 43166380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).