C16H14ClNO3 — CID 43166910
2-chloro-6-(1,2,3,4-tetrahydronaphthalen-1-yloxy)pyridine-4-carboxylic acid (PubChem CID 43166910) has the molecular formula C16H14ClNO3 and a molecular weight of 303.75 g/mol. Its IUPAC name is 2-chloro-6-(1,2,3,4-tetrahydronaphthalen-1-yloxy)pyridine-4-carboxylic acid.
| Compound Name | 2-chloro-6-(1,2,3,4-tetrahydronaphthalen-1-yloxy)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 43166910 |
| Molecular Formula | C16H14ClNO3 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 2-chloro-6-(1,2,3,4-tetrahydronaphthalen-1-yloxy)pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1cc(Cl)nc(OC2CCCc3ccccc32)c1 |
| InChI | InChI=1S/C16H14ClNO3/c17-14-8-11(16(19)20)9-15(18-14)21-13-7-3-5-10-4-1-2-6-12(10)13/h1-2,4,6,8-9,13H,3,5,7H2,(H,19,20) |
| InChIKey | KTQGDMZUNOPDIL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|