About (4-butylcyclohexyl)-(2,5-dichlorothiophen-3-yl)methanamine
(4-butylcyclohexyl)-(2,5-dichlorothiophen-3-yl)methanamine (PubChem CID 43167363) has the molecular formula C15H23Cl2NS
and a molecular weight of 320.33 g/mol. Its IUPAC name is (4-butylcyclohexyl)-(2,5-dichlorothiophen-3-yl)methanamine.
Molecular Properties
| Compound Name | (4-butylcyclohexyl)-(2,5-dichlorothiophen-3-yl)methanamine |
| PubChem CID | 43167363 |
| Molecular Formula | C15H23Cl2NS |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | (4-butylcyclohexyl)-(2,5-dichlorothiophen-3-yl)methanamine |
| SMILES | CCCCC1CCC(C(N)c2cc(Cl)sc2Cl)CC1 |
| InChI | InChI=1S/C15H23Cl2NS/c1-2-3-4-10-5-7-11(8-6-10)14(18)12-9-13(16)19-15(12)17/h9-11,14H,2-8,18H2,1H3 |
| InChIKey | GGGIVRMGDGSUIS-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-butylcyclohexyl)-(2,5-dichlorothiophen-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-butylcyclohexyl)-(2,5-dichlorothiophen-3-yl)methanamine?
The IUPAC name of (4-butylcyclohexyl)-(2,5-dichlorothiophen-3-yl)methanamine (CID 43167363) is (4-butylcyclohexyl)-(2,5-dichlorothiophen-3-yl)methanamine.
What is the SMILES notation for (4-butylcyclohexyl)-(2,5-dichlorothiophen-3-yl)methanamine?
The canonical SMILES for (4-butylcyclohexyl)-(2,5-dichlorothiophen-3-yl)methanamine is CCCCC1CCC(C(N)c2cc(Cl)sc2Cl)CC1.
What is the InChIKey of (4-butylcyclohexyl)-(2,5-dichlorothiophen-3-yl)methanamine?
The InChIKey is GGGIVRMGDGSUIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23Cl2NS/c1-2-3-4-10-5-7-11(8-6-10)14(18)12-9-13(16)19-15(12)17/h9-11,14H,2-8,18H2,1H3.
What are the key properties of (4-butylcyclohexyl)-(2,5-dichlorothiophen-3-yl)methanamine?
(4-butylcyclohexyl)-(2,5-dichlorothiophen-3-yl)methanamine has a molecular weight of 320.33 g/mol, XLogP of 6.05, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-butylcyclohexyl)-(2,5-dichlorothiophen-3-yl)methanamine is sourced from PubChem (CID 43167363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).