5-(2,5-dichlorothiophen-3-yl)pentanoic acid

C9H10Cl2O2S — CID 43167366

IUPAC5-(2,5-dichlorothiophen-3-yl)pentanoic acid
SMILESO=C(O)CCCCc1cc(Cl)sc1Cl
InChIInChI=1S/C9H10Cl2O2S/c10-7-5-6(9(11)14-7)3-1-2-4-8(12)13/h5H,1-4H2,(H,12,13)
InChIKeyCIZUJXFIODFXGW-UHFFFAOYSA-N
MW253.15 g/mol
LogP3.85
Rot. Bonds5

About 5-(2,5-dichlorothiophen-3-yl)pentanoic acid

5-(2,5-dichlorothiophen-3-yl)pentanoic acid (PubChem CID 43167366) has the molecular formula C9H10Cl2O2S and a molecular weight of 253.15 g/mol. Its IUPAC name is 5-(2,5-dichlorothiophen-3-yl)pentanoic acid.

Molecular Properties

Compound Name5-(2,5-dichlorothiophen-3-yl)pentanoic acid
PubChem CID43167366
Molecular FormulaC9H10Cl2O2S
Molecular Weight253.15 g/mol
Exact Mass251.98
IUPAC Name5-(2,5-dichlorothiophen-3-yl)pentanoic acid
SMILESO=C(O)CCCCc1cc(Cl)sc1Cl
InChIInChI=1S/C9H10Cl2O2S/c10-7-5-6(9(11)14-7)3-1-2-4-8(12)13/h5H,1-4H2,(H,12,13)
InChIKeyCIZUJXFIODFXGW-UHFFFAOYSA-N
XLogP3.85
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.15
LogP ≤ 53.85
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 5-(2,5-dichlorothiophen-3-yl)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2,5-dichlorothiophen-3-yl)pentanoic acid?
The IUPAC name of 5-(2,5-dichlorothiophen-3-yl)pentanoic acid (CID 43167366) is 5-(2,5-dichlorothiophen-3-yl)pentanoic acid.
What is the SMILES notation for 5-(2,5-dichlorothiophen-3-yl)pentanoic acid?
The canonical SMILES for 5-(2,5-dichlorothiophen-3-yl)pentanoic acid is O=C(O)CCCCc1cc(Cl)sc1Cl.
What is the InChIKey of 5-(2,5-dichlorothiophen-3-yl)pentanoic acid?
The InChIKey is CIZUJXFIODFXGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10Cl2O2S/c10-7-5-6(9(11)14-7)3-1-2-4-8(12)13/h5H,1-4H2,(H,12,13).
What are the key properties of 5-(2,5-dichlorothiophen-3-yl)pentanoic acid?
5-(2,5-dichlorothiophen-3-yl)pentanoic acid has a molecular weight of 253.15 g/mol, XLogP of 3.85, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,5-dichlorothiophen-3-yl)pentanoic acid is sourced from PubChem (CID 43167366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).