About 6,7-difluoro-1,1-dioxo-2,3-dihydrothiochromen-4-one
6,7-difluoro-1,1-dioxo-2,3-dihydrothiochromen-4-one (PubChem CID 43167472) has the molecular formula C9H6F2O3S
and a molecular weight of 232.21 g/mol. Its IUPAC name is 6,7-difluoro-1,1-dioxo-2,3-dihydrothiochromen-4-one.
Molecular Properties
| Compound Name | 6,7-difluoro-1,1-dioxo-2,3-dihydrothiochromen-4-one |
| PubChem CID | 43167472 |
| Molecular Formula | C9H6F2O3S |
| Molecular Weight | 232.21 g/mol |
| Exact Mass | 232.00 |
| IUPAC Name | 6,7-difluoro-1,1-dioxo-2,3-dihydrothiochromen-4-one |
| SMILES | O=C1CCS(=O)(=O)c2cc(F)c(F)cc21 |
| InChI | InChI=1S/C9H6F2O3S/c10-6-3-5-8(12)1-2-15(13,14)9(5)4-7(6)11/h3-4H,1-2H2 |
| InChIKey | ZVYNFAGJGYRWSW-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.21 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,7-difluoro-1,1-dioxo-2,3-dihydrothiochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-difluoro-1,1-dioxo-2,3-dihydrothiochromen-4-one?
The IUPAC name of 6,7-difluoro-1,1-dioxo-2,3-dihydrothiochromen-4-one (CID 43167472) is 6,7-difluoro-1,1-dioxo-2,3-dihydrothiochromen-4-one.
What is the SMILES notation for 6,7-difluoro-1,1-dioxo-2,3-dihydrothiochromen-4-one?
The canonical SMILES for 6,7-difluoro-1,1-dioxo-2,3-dihydrothiochromen-4-one is O=C1CCS(=O)(=O)c2cc(F)c(F)cc21.
What is the InChIKey of 6,7-difluoro-1,1-dioxo-2,3-dihydrothiochromen-4-one?
The InChIKey is ZVYNFAGJGYRWSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F2O3S/c10-6-3-5-8(12)1-2-15(13,14)9(5)4-7(6)11/h3-4H,1-2H2.
What are the key properties of 6,7-difluoro-1,1-dioxo-2,3-dihydrothiochromen-4-one?
6,7-difluoro-1,1-dioxo-2,3-dihydrothiochromen-4-one has a molecular weight of 232.21 g/mol, XLogP of 1.32, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-difluoro-1,1-dioxo-2,3-dihydrothiochromen-4-one is sourced from PubChem (CID 43167472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).