C12H6ClF2NO2S — CID 43167548
2-chloro-6-(2,4-difluorophenyl)sulfanylpyridine-4-carboxylic acid (PubChem CID 43167548) has the molecular formula C12H6ClF2NO2S and a molecular weight of 301.70 g/mol. Its IUPAC name is 2-chloro-6-(2,4-difluorophenyl)sulfanylpyridine-4-carboxylic acid.
| Compound Name | 2-chloro-6-(2,4-difluorophenyl)sulfanylpyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 43167548 |
| Molecular Formula | C12H6ClF2NO2S |
| Molecular Weight | 301.70 g/mol |
| Exact Mass | 300.98 |
| IUPAC Name | 2-chloro-6-(2,4-difluorophenyl)sulfanylpyridine-4-carboxylic acid |
| SMILES | O=C(O)c1cc(Cl)nc(Sc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C12H6ClF2NO2S/c13-10-3-6(12(17)18)4-11(16-10)19-9-2-1-7(14)5-8(9)15/h1-5H,(H,17,18) |
| InChIKey | LMJRWVCACPRXSQ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.70 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|