About 4-methyl-N-piperidin-4-yl-1,3-thiazole-5-carboxamide
4-methyl-N-piperidin-4-yl-1,3-thiazole-5-carboxamide (PubChem CID 43167642) has the molecular formula C10H15N3OS
and a molecular weight of 225.32 g/mol. Its IUPAC name is 4-methyl-N-piperidin-4-yl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 4-methyl-N-piperidin-4-yl-1,3-thiazole-5-carboxamide |
| PubChem CID | 43167642 |
| Molecular Formula | C10H15N3OS |
| Molecular Weight | 225.32 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 4-methyl-N-piperidin-4-yl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ncsc1C(=O)NC1CCNCC1 |
| InChI | InChI=1S/C10H15N3OS/c1-7-9(15-6-12-7)10(14)13-8-2-4-11-5-3-8/h6,8,11H,2-5H2,1H3,(H,13,14) |
| InChIKey | NRJRPCAXGQMXOO-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.32 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methyl-N-piperidin-4-yl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-N-piperidin-4-yl-1,3-thiazole-5-carboxamide?
The IUPAC name of 4-methyl-N-piperidin-4-yl-1,3-thiazole-5-carboxamide (CID 43167642) is 4-methyl-N-piperidin-4-yl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 4-methyl-N-piperidin-4-yl-1,3-thiazole-5-carboxamide?
The canonical SMILES for 4-methyl-N-piperidin-4-yl-1,3-thiazole-5-carboxamide is Cc1ncsc1C(=O)NC1CCNCC1.
What is the InChIKey of 4-methyl-N-piperidin-4-yl-1,3-thiazole-5-carboxamide?
The InChIKey is NRJRPCAXGQMXOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3OS/c1-7-9(15-6-12-7)10(14)13-8-2-4-11-5-3-8/h6,8,11H,2-5H2,1H3,(H,13,14).
What are the key properties of 4-methyl-N-piperidin-4-yl-1,3-thiazole-5-carboxamide?
4-methyl-N-piperidin-4-yl-1,3-thiazole-5-carboxamide has a molecular weight of 225.32 g/mol, XLogP of 0.93, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-N-piperidin-4-yl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 43167642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).