About N-piperidin-4-yl-2-(1,2,4-triazol-1-yl)acetamide
N-piperidin-4-yl-2-(1,2,4-triazol-1-yl)acetamide (PubChem CID 43167655) has the molecular formula C9H15N5O
and a molecular weight of 209.25 g/mol. Its IUPAC name is N-piperidin-4-yl-2-(1,2,4-triazol-1-yl)acetamide.
Molecular Properties
| Compound Name | N-piperidin-4-yl-2-(1,2,4-triazol-1-yl)acetamide |
| PubChem CID | 43167655 |
| Molecular Formula | C9H15N5O |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | N-piperidin-4-yl-2-(1,2,4-triazol-1-yl)acetamide |
| SMILES | O=C(Cn1cncn1)NC1CCNCC1 |
| InChI | InChI=1S/C9H15N5O/c15-9(5-14-7-11-6-12-14)13-8-1-3-10-4-2-8/h6-8,10H,1-5H2,(H,13,15) |
| InChIKey | PWEUTVKCFXNXLC-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-piperidin-4-yl-2-(1,2,4-triazol-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-piperidin-4-yl-2-(1,2,4-triazol-1-yl)acetamide?
The IUPAC name of N-piperidin-4-yl-2-(1,2,4-triazol-1-yl)acetamide (CID 43167655) is N-piperidin-4-yl-2-(1,2,4-triazol-1-yl)acetamide.
What is the SMILES notation for N-piperidin-4-yl-2-(1,2,4-triazol-1-yl)acetamide?
The canonical SMILES for N-piperidin-4-yl-2-(1,2,4-triazol-1-yl)acetamide is O=C(Cn1cncn1)NC1CCNCC1.
What is the InChIKey of N-piperidin-4-yl-2-(1,2,4-triazol-1-yl)acetamide?
The InChIKey is PWEUTVKCFXNXLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N5O/c15-9(5-14-7-11-6-12-14)13-8-1-3-10-4-2-8/h6-8,10H,1-5H2,(H,13,15).
What are the key properties of N-piperidin-4-yl-2-(1,2,4-triazol-1-yl)acetamide?
N-piperidin-4-yl-2-(1,2,4-triazol-1-yl)acetamide has a molecular weight of 209.25 g/mol, XLogP of -0.85, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-piperidin-4-yl-2-(1,2,4-triazol-1-yl)acetamide is sourced from PubChem (CID 43167655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).