About 5-amino-2,4-difluoro-N-(3-hydroxypropyl)benzenesulfonamide
5-amino-2,4-difluoro-N-(3-hydroxypropyl)benzenesulfonamide (PubChem CID 43167687) has the molecular formula C9H12F2N2O3S
and a molecular weight of 266.27 g/mol. Its IUPAC name is 5-amino-2,4-difluoro-N-(3-hydroxypropyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 5-amino-2,4-difluoro-N-(3-hydroxypropyl)benzenesulfonamide |
| PubChem CID | 43167687 |
| Molecular Formula | C9H12F2N2O3S |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 5-amino-2,4-difluoro-N-(3-hydroxypropyl)benzenesulfonamide |
| SMILES | Nc1cc(S(=O)(=O)NCCCO)c(F)cc1F |
| InChI | InChI=1S/C9H12F2N2O3S/c10-6-4-7(11)9(5-8(6)12)17(15,16)13-2-1-3-14/h4-5,13-14H,1-3,12H2 |
| InChIKey | CPLSZGWTEIROIG-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2,4-difluoro-N-(3-hydroxypropyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2,4-difluoro-N-(3-hydroxypropyl)benzenesulfonamide?
The IUPAC name of 5-amino-2,4-difluoro-N-(3-hydroxypropyl)benzenesulfonamide (CID 43167687) is 5-amino-2,4-difluoro-N-(3-hydroxypropyl)benzenesulfonamide.
What is the SMILES notation for 5-amino-2,4-difluoro-N-(3-hydroxypropyl)benzenesulfonamide?
The canonical SMILES for 5-amino-2,4-difluoro-N-(3-hydroxypropyl)benzenesulfonamide is Nc1cc(S(=O)(=O)NCCCO)c(F)cc1F.
What is the InChIKey of 5-amino-2,4-difluoro-N-(3-hydroxypropyl)benzenesulfonamide?
The InChIKey is CPLSZGWTEIROIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F2N2O3S/c10-6-4-7(11)9(5-8(6)12)17(15,16)13-2-1-3-14/h4-5,13-14H,1-3,12H2.
What are the key properties of 5-amino-2,4-difluoro-N-(3-hydroxypropyl)benzenesulfonamide?
5-amino-2,4-difluoro-N-(3-hydroxypropyl)benzenesulfonamide has a molecular weight of 266.27 g/mol, XLogP of 0.21, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2,4-difluoro-N-(3-hydroxypropyl)benzenesulfonamide is sourced from PubChem (CID 43167687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).