About 2-[(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)-methylamino]ethanol
2-[(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)-methylamino]ethanol (PubChem CID 43167700) has the molecular formula C11H16N2O3
and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-[(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)-methylamino]ethanol.
Molecular Properties
| Compound Name | 2-[(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)-methylamino]ethanol |
| PubChem CID | 43167700 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 2-[(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)-methylamino]ethanol |
| SMILES | CN(CCO)c1cc2c(cc1N)OCCO2 |
| InChI | InChI=1S/C11H16N2O3/c1-13(2-3-14)9-7-11-10(6-8(9)12)15-4-5-16-11/h6-7,14H,2-5,12H2,1H3 |
| InChIKey | NRBNCWKLYSKALT-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 67.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)-methylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)-methylamino]ethanol?
The IUPAC name of 2-[(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)-methylamino]ethanol (CID 43167700) is 2-[(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)-methylamino]ethanol.
What is the SMILES notation for 2-[(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)-methylamino]ethanol?
The canonical SMILES for 2-[(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)-methylamino]ethanol is CN(CCO)c1cc2c(cc1N)OCCO2.
What is the InChIKey of 2-[(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)-methylamino]ethanol?
The InChIKey is NRBNCWKLYSKALT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O3/c1-13(2-3-14)9-7-11-10(6-8(9)12)15-4-5-16-11/h6-7,14H,2-5,12H2,1H3.
What are the key properties of 2-[(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)-methylamino]ethanol?
2-[(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)-methylamino]ethanol has a molecular weight of 224.26 g/mol, XLogP of 0.47, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(7-amino-2,3-dihydro-1,4-benzodioxin-6-yl)-methylamino]ethanol is sourced from PubChem (CID 43167700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).