About 2-bromo-N-[(5-chlorothiophen-2-yl)methyl]-4,6-difluoroaniline
2-bromo-N-[(5-chlorothiophen-2-yl)methyl]-4,6-difluoroaniline (PubChem CID 43168246) has the molecular formula C11H7BrClF2NS
and a molecular weight of 338.60 g/mol. Its IUPAC name is 2-bromo-N-[(5-chlorothiophen-2-yl)methyl]-4,6-difluoroaniline.
Molecular Properties
| Compound Name | 2-bromo-N-[(5-chlorothiophen-2-yl)methyl]-4,6-difluoroaniline |
| PubChem CID | 43168246 |
| Molecular Formula | C11H7BrClF2NS |
| Molecular Weight | 338.60 g/mol |
| Exact Mass | 336.91 |
| IUPAC Name | 2-bromo-N-[(5-chlorothiophen-2-yl)methyl]-4,6-difluoroaniline |
| SMILES | Fc1cc(F)c(NCc2ccc(Cl)s2)c(Br)c1 |
| InChI | InChI=1S/C11H7BrClF2NS/c12-8-3-6(14)4-9(15)11(8)16-5-7-1-2-10(13)17-7/h1-4,16H,5H2 |
| InChIKey | VNUJAQSLNBBFLB-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.60 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-bromo-N-[(5-chlorothiophen-2-yl)methyl]-4,6-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N-[(5-chlorothiophen-2-yl)methyl]-4,6-difluoroaniline?
The IUPAC name of 2-bromo-N-[(5-chlorothiophen-2-yl)methyl]-4,6-difluoroaniline (CID 43168246) is 2-bromo-N-[(5-chlorothiophen-2-yl)methyl]-4,6-difluoroaniline.
What is the SMILES notation for 2-bromo-N-[(5-chlorothiophen-2-yl)methyl]-4,6-difluoroaniline?
The canonical SMILES for 2-bromo-N-[(5-chlorothiophen-2-yl)methyl]-4,6-difluoroaniline is Fc1cc(F)c(NCc2ccc(Cl)s2)c(Br)c1.
What is the InChIKey of 2-bromo-N-[(5-chlorothiophen-2-yl)methyl]-4,6-difluoroaniline?
The InChIKey is VNUJAQSLNBBFLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7BrClF2NS/c12-8-3-6(14)4-9(15)11(8)16-5-7-1-2-10(13)17-7/h1-4,16H,5H2.
What are the key properties of 2-bromo-N-[(5-chlorothiophen-2-yl)methyl]-4,6-difluoroaniline?
2-bromo-N-[(5-chlorothiophen-2-yl)methyl]-4,6-difluoroaniline has a molecular weight of 338.60 g/mol, XLogP of 5.05, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N-[(5-chlorothiophen-2-yl)methyl]-4,6-difluoroaniline is sourced from PubChem (CID 43168246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).