About 1-(1,3-dioxan-4-ylmethyl)-1,4-diazepane
1-(1,3-dioxan-4-ylmethyl)-1,4-diazepane (PubChem CID 43168670) has the molecular formula C10H20N2O2
and a molecular weight of 200.28 g/mol. Its IUPAC name is 1-(1,3-dioxan-4-ylmethyl)-1,4-diazepane.
Molecular Properties
| Compound Name | 1-(1,3-dioxan-4-ylmethyl)-1,4-diazepane |
| PubChem CID | 43168670 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | 1-(1,3-dioxan-4-ylmethyl)-1,4-diazepane |
| SMILES | C1CNCCN(CC2CCOCO2)C1 |
| InChI | InChI=1S/C10H20N2O2/c1-3-11-4-6-12(5-1)8-10-2-7-13-9-14-10/h10-11H,1-9H2 |
| InChIKey | QVZMNMKCUKUMOW-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(1,3-dioxan-4-ylmethyl)-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-dioxan-4-ylmethyl)-1,4-diazepane?
The IUPAC name of 1-(1,3-dioxan-4-ylmethyl)-1,4-diazepane (CID 43168670) is 1-(1,3-dioxan-4-ylmethyl)-1,4-diazepane.
What is the SMILES notation for 1-(1,3-dioxan-4-ylmethyl)-1,4-diazepane?
The canonical SMILES for 1-(1,3-dioxan-4-ylmethyl)-1,4-diazepane is C1CNCCN(CC2CCOCO2)C1.
What is the InChIKey of 1-(1,3-dioxan-4-ylmethyl)-1,4-diazepane?
The InChIKey is QVZMNMKCUKUMOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O2/c1-3-11-4-6-12(5-1)8-10-2-7-13-9-14-10/h10-11H,1-9H2.
What are the key properties of 1-(1,3-dioxan-4-ylmethyl)-1,4-diazepane?
1-(1,3-dioxan-4-ylmethyl)-1,4-diazepane has a molecular weight of 200.28 g/mol, XLogP of 0.04, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-dioxan-4-ylmethyl)-1,4-diazepane is sourced from PubChem (CID 43168670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).