C10H8ClF4NO3 — CID 43169228
1-chloro-4-nitro-2-(2,2,3,3-tetrafluoropropoxymethyl)benzene (PubChem CID 43169228) has the molecular formula C10H8ClF4NO3 and a molecular weight of 301.62 g/mol. Its IUPAC name is 1-chloro-4-nitro-2-(2,2,3,3-tetrafluoropropoxymethyl)benzene.
| Compound Name | 1-chloro-4-nitro-2-(2,2,3,3-tetrafluoropropoxymethyl)benzene |
|---|---|
| PubChem CID | 43169228 |
| Molecular Formula | C10H8ClF4NO3 |
| Molecular Weight | 301.62 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | 1-chloro-4-nitro-2-(2,2,3,3-tetrafluoropropoxymethyl)benzene |
| SMILES | O=[N+]([O-])c1ccc(Cl)c(COCC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C10H8ClF4NO3/c11-8-2-1-7(16(17)18)3-6(8)4-19-5-10(14,15)9(12)13/h1-3,9H,4-5H2 |
| InChIKey | QOUGRXVOURFPKU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.62 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|