C9H16N2O2 — CID 43169260
N-(3-amino-3-oxopropyl)cyclopentanecarboxamide (PubChem CID 43169260) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is N-(3-amino-3-oxopropyl)cyclopentanecarboxamide.
| Compound Name | N-(3-amino-3-oxopropyl)cyclopentanecarboxamide |
|---|---|
| PubChem CID | 43169260 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | N-(3-amino-3-oxopropyl)cyclopentanecarboxamide |
| SMILES | NC(=O)CCNC(=O)C1CCCC1 |
| InChI | InChI=1S/C9H16N2O2/c10-8(12)5-6-11-9(13)7-3-1-2-4-7/h7H,1-6H2,(H2,10,12)(H,11,13) |
| InChIKey | IBRHDGKAPZMULB-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |