C11H12N4O4S — CID 43169285
4-[2-(2-cyanoethylamino)-2-oxoethyl]sulfanyl-6-methyl-2-oxo-1H-pyrimidine-5-carboxylic acid (PubChem CID 43169285) has the molecular formula C11H12N4O4S and a molecular weight of 296.31 g/mol. Its IUPAC name is 4-[2-(2-cyanoethylamino)-2-oxoethyl]sulfanyl-6-methyl-2-oxo-1H-pyrimidine-5-carboxylic acid.
| Compound Name | 4-[2-(2-cyanoethylamino)-2-oxoethyl]sulfanyl-6-methyl-2-oxo-1H-pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 43169285 |
| Molecular Formula | C11H12N4O4S |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 4-[2-(2-cyanoethylamino)-2-oxoethyl]sulfanyl-6-methyl-2-oxo-1H-pyrimidine-5-carboxylic acid |
| SMILES | Cc1[nH]c(=O)nc(SCC(=O)NCCC#N)c1C(=O)O |
| InChI | InChI=1S/C11H12N4O4S/c1-6-8(10(17)18)9(15-11(19)14-6)20-5-7(16)13-4-2-3-12/h2,4-5H2,1H3,(H,13,16)(H,17,18)(H,14,15,19) |
| InChIKey | VEYAVIOFERLXJW-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 135.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|