C11H13N3S — CID 43169315
5-(1-phenylpropyl)-1,2-dihydro-1,2,4-triazole-3-thione (PubChem CID 43169315) has the molecular formula C11H13N3S and a molecular weight of 219.31 g/mol. Its IUPAC name is 5-(1-phenylpropyl)-1,2-dihydro-1,2,4-triazole-3-thione.
| Compound Name | 5-(1-phenylpropyl)-1,2-dihydro-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 43169315 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 5-(1-phenylpropyl)-1,2-dihydro-1,2,4-triazole-3-thione |
| SMILES | CCC(c1ccccc1)c1nc(=S)[nH][nH]1 |
| InChI | InChI=1S/C11H13N3S/c1-2-9(8-6-4-3-5-7-8)10-12-11(15)14-13-10/h3-7,9H,2H2,1H3,(H2,12,13,14,15) |
| InChIKey | DMXNYBAQYMZVHW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|