About 1-[[2-(3,4-difluorophenyl)sulfanylacetyl]amino]cyclopentane-1-carboxylic acid
1-[[2-(3,4-difluorophenyl)sulfanylacetyl]amino]cyclopentane-1-carboxylic acid (PubChem CID 43169416) has the molecular formula C14H15F2NO3S
and a molecular weight of 315.34 g/mol. Its IUPAC name is 1-[[2-(3,4-difluorophenyl)sulfanylacetyl]amino]cyclopentane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-[[2-(3,4-difluorophenyl)sulfanylacetyl]amino]cyclopentane-1-carboxylic acid |
| PubChem CID | 43169416 |
| Molecular Formula | C14H15F2NO3S |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 1-[[2-(3,4-difluorophenyl)sulfanylacetyl]amino]cyclopentane-1-carboxylic acid |
| SMILES | O=C(CSc1ccc(F)c(F)c1)NC1(C(=O)O)CCCC1 |
| InChI | InChI=1S/C14H15F2NO3S/c15-10-4-3-9(7-11(10)16)21-8-12(18)17-14(13(19)20)5-1-2-6-14/h3-4,7H,1-2,5-6,8H2,(H,17,18)(H,19,20) |
| InChIKey | QKUDXCAHAXCAIO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[[2-(3,4-difluorophenyl)sulfanylacetyl]amino]cyclopentane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2-(3,4-difluorophenyl)sulfanylacetyl]amino]cyclopentane-1-carboxylic acid?
The IUPAC name of 1-[[2-(3,4-difluorophenyl)sulfanylacetyl]amino]cyclopentane-1-carboxylic acid (CID 43169416) is 1-[[2-(3,4-difluorophenyl)sulfanylacetyl]amino]cyclopentane-1-carboxylic acid.
What is the SMILES notation for 1-[[2-(3,4-difluorophenyl)sulfanylacetyl]amino]cyclopentane-1-carboxylic acid?
The canonical SMILES for 1-[[2-(3,4-difluorophenyl)sulfanylacetyl]amino]cyclopentane-1-carboxylic acid is O=C(CSc1ccc(F)c(F)c1)NC1(C(=O)O)CCCC1.
What is the InChIKey of 1-[[2-(3,4-difluorophenyl)sulfanylacetyl]amino]cyclopentane-1-carboxylic acid?
The InChIKey is QKUDXCAHAXCAIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F2NO3S/c15-10-4-3-9(7-11(10)16)21-8-12(18)17-14(13(19)20)5-1-2-6-14/h3-4,7H,1-2,5-6,8H2,(H,17,18)(H,19,20).
What are the key properties of 1-[[2-(3,4-difluorophenyl)sulfanylacetyl]amino]cyclopentane-1-carboxylic acid?
1-[[2-(3,4-difluorophenyl)sulfanylacetyl]amino]cyclopentane-1-carboxylic acid has a molecular weight of 315.34 g/mol, XLogP of 2.57, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2-(3,4-difluorophenyl)sulfanylacetyl]amino]cyclopentane-1-carboxylic acid is sourced from PubChem (CID 43169416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).