C12H17N5O3S — CID 43169495
1-[[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]amino]cyclopentane-1-carboxylic acid (PubChem CID 43169495) has the molecular formula C12H17N5O3S and a molecular weight of 311.37 g/mol. Its IUPAC name is 1-[[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]amino]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]amino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 43169495 |
| Molecular Formula | C12H17N5O3S |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 1-[[2-(1-cyclopropyltetrazol-5-yl)sulfanylacetyl]amino]cyclopentane-1-carboxylic acid |
| SMILES | O=C(CSc1nnnn1C1CC1)NC1(C(=O)O)CCCC1 |
| InChI | InChI=1S/C12H17N5O3S/c18-9(13-12(10(19)20)5-1-2-6-12)7-21-11-14-15-16-17(11)8-3-4-8/h8H,1-7H2,(H,13,18)(H,19,20) |
| InChIKey | RAIRXRWAFGPMLK-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |