About 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonylamino]butanoic acid
3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonylamino]butanoic acid (PubChem CID 43169509) has the molecular formula C8H11N3O6S
and a molecular weight of 277.26 g/mol. Its IUPAC name is 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonylamino]butanoic acid.
Molecular Properties
| Compound Name | 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonylamino]butanoic acid |
| PubChem CID | 43169509 |
| Molecular Formula | C8H11N3O6S |
| Molecular Weight | 277.26 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonylamino]butanoic acid |
| SMILES | CC(CC(=O)O)NS(=O)(=O)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H11N3O6S/c1-4(2-6(12)13)11-18(16,17)5-3-9-8(15)10-7(5)14/h3-4,11H,2H2,1H3,(H,12,13)(H2,9,10,14,15) |
| InChIKey | NBPUXPYABLFISO-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 149.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.26 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonylamino]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonylamino]butanoic acid?
The IUPAC name of 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonylamino]butanoic acid (CID 43169509) is 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonylamino]butanoic acid.
What is the SMILES notation for 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonylamino]butanoic acid?
The canonical SMILES for 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonylamino]butanoic acid is CC(CC(=O)O)NS(=O)(=O)c1c[nH]c(=O)[nH]c1=O.
What is the InChIKey of 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonylamino]butanoic acid?
The InChIKey is NBPUXPYABLFISO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O6S/c1-4(2-6(12)13)11-18(16,17)5-3-9-8(15)10-7(5)14/h3-4,11H,2H2,1H3,(H,12,13)(H2,9,10,14,15).
What are the key properties of 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonylamino]butanoic acid?
3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonylamino]butanoic acid has a molecular weight of 277.26 g/mol, XLogP of -1.80, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonylamino]butanoic acid is sourced from PubChem (CID 43169509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).