C13H15NO5S — CID 43169836
2-[2-(3-carboxypropylamino)-2-oxoethyl]sulfanylbenzoic acid (PubChem CID 43169836) has the molecular formula C13H15NO5S and a molecular weight of 297.33 g/mol. Its IUPAC name is 2-[2-(3-carboxypropylamino)-2-oxoethyl]sulfanylbenzoic acid.
| Compound Name | 2-[2-(3-carboxypropylamino)-2-oxoethyl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 43169836 |
| Molecular Formula | C13H15NO5S |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 2-[2-(3-carboxypropylamino)-2-oxoethyl]sulfanylbenzoic acid |
| SMILES | O=C(O)CCCNC(=O)CSc1ccccc1C(=O)O |
| InChI | InChI=1S/C13H15NO5S/c15-11(14-7-3-6-12(16)17)8-20-10-5-2-1-4-9(10)13(18)19/h1-2,4-5H,3,6-8H2,(H,14,15)(H,16,17)(H,18,19) |
| InChIKey | VKROCMYBLONAAR-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|