C11H17NO2S2 — CID 43169897
3-[(2-tert-butyl-1,3-thiazol-4-yl)methylsulfanyl]propanoic acid (PubChem CID 43169897) has the molecular formula C11H17NO2S2 and a molecular weight of 259.40 g/mol. Its IUPAC name is 3-[(2-tert-butyl-1,3-thiazol-4-yl)methylsulfanyl]propanoic acid.
| Compound Name | 3-[(2-tert-butyl-1,3-thiazol-4-yl)methylsulfanyl]propanoic acid |
|---|---|
| PubChem CID | 43169897 |
| Molecular Formula | C11H17NO2S2 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 3-[(2-tert-butyl-1,3-thiazol-4-yl)methylsulfanyl]propanoic acid |
| SMILES | CC(C)(C)c1nc(CSCCC(=O)O)cs1 |
| InChI | InChI=1S/C11H17NO2S2/c1-11(2,3)10-12-8(7-16-10)6-15-5-4-9(13)14/h7H,4-6H2,1-3H3,(H,13,14) |
| InChIKey | OWKPDGPWXVISRN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|