C13H18ClNO3S2 — CID 43170042
6-[[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]amino]hexanoic acid (PubChem CID 43170042) has the molecular formula C13H18ClNO3S2 and a molecular weight of 335.88 g/mol. Its IUPAC name is 6-[[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]amino]hexanoic acid.
| Compound Name | 6-[[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 43170042 |
| Molecular Formula | C13H18ClNO3S2 |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 6-[[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)CSCc1ccc(Cl)s1 |
| InChI | InChI=1S/C13H18ClNO3S2/c14-11-6-5-10(20-11)8-19-9-12(16)15-7-3-1-2-4-13(17)18/h5-6H,1-4,7-9H2,(H,15,16)(H,17,18) |
| InChIKey | JIDPGBFTONZCBX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|