About 1-[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]piperidine-4-carboxylic acid
1-[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]piperidine-4-carboxylic acid (PubChem CID 43170467) has the molecular formula C12H16N2O4S
and a molecular weight of 284.34 g/mol. Its IUPAC name is 1-[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]piperidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]piperidine-4-carboxylic acid |
| PubChem CID | 43170467 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 1-[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]piperidine-4-carboxylic acid |
| SMILES | Cc1csc(=O)n1CC(=O)N1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C12H16N2O4S/c1-8-7-19-12(18)14(8)6-10(15)13-4-2-9(3-5-13)11(16)17/h7,9H,2-6H2,1H3,(H,16,17) |
| InChIKey | PCQHBSBDFDLVDM-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]piperidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]piperidine-4-carboxylic acid?
The IUPAC name of 1-[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]piperidine-4-carboxylic acid (CID 43170467) is 1-[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]piperidine-4-carboxylic acid.
What is the SMILES notation for 1-[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]piperidine-4-carboxylic acid?
The canonical SMILES for 1-[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]piperidine-4-carboxylic acid is Cc1csc(=O)n1CC(=O)N1CCC(C(=O)O)CC1.
What is the InChIKey of 1-[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]piperidine-4-carboxylic acid?
The InChIKey is PCQHBSBDFDLVDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O4S/c1-8-7-19-12(18)14(8)6-10(15)13-4-2-9(3-5-13)11(16)17/h7,9H,2-6H2,1H3,(H,16,17).
What are the key properties of 1-[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]piperidine-4-carboxylic acid?
1-[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]piperidine-4-carboxylic acid has a molecular weight of 284.34 g/mol, XLogP of 0.54, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(4-methyl-2-oxo-1,3-thiazol-3-yl)acetyl]piperidine-4-carboxylic acid is sourced from PubChem (CID 43170467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).