4-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]butanoic acid

C10H13N3O5 — CID 43170711

IUPAC4-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]butanoic acid
SMILESO=C(O)CCCNC(=O)Cn1[nH]c(=O)ccc1=O
InChIInChI=1S/C10H13N3O5/c14-7-3-4-9(16)13(12-7)6-8(15)11-5-1-2-10(17)18/h3-4H,1-2,5-6H2,(H,11,15)(H,12,14)(H,17,18)
InChIKeySELAGKXTXXBJPI-UHFFFAOYSA-N
MW255.23 g/mol
LogP-1.48
Rot. Bonds6

About 4-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]butanoic acid

4-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]butanoic acid (PubChem CID 43170711) has the molecular formula C10H13N3O5 and a molecular weight of 255.23 g/mol. Its IUPAC name is 4-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]butanoic acid.

Molecular Properties

Compound Name4-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]butanoic acid
PubChem CID43170711
Molecular FormulaC10H13N3O5
Molecular Weight255.23 g/mol
Exact Mass255.09
IUPAC Name4-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]butanoic acid
SMILESO=C(O)CCCNC(=O)Cn1[nH]c(=O)ccc1=O
InChIInChI=1S/C10H13N3O5/c14-7-3-4-9(16)13(12-7)6-8(15)11-5-1-2-10(17)18/h3-4H,1-2,5-6H2,(H,11,15)(H,12,14)(H,17,18)
InChIKeySELAGKXTXXBJPI-UHFFFAOYSA-N
XLogP-1.48
TPSA121.26 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.23
LogP ≤ 5-1.48
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]butanoic acid?
The IUPAC name of 4-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]butanoic acid (CID 43170711) is 4-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]butanoic acid.
What is the SMILES notation for 4-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]butanoic acid?
The canonical SMILES for 4-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]butanoic acid is O=C(O)CCCNC(=O)Cn1[nH]c(=O)ccc1=O.
What is the InChIKey of 4-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]butanoic acid?
The InChIKey is SELAGKXTXXBJPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O5/c14-7-3-4-9(16)13(12-7)6-8(15)11-5-1-2-10(17)18/h3-4H,1-2,5-6H2,(H,11,15)(H,12,14)(H,17,18).
What are the key properties of 4-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]butanoic acid?
4-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]butanoic acid has a molecular weight of 255.23 g/mol, XLogP of -1.48, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-(3,6-dioxo-1H-pyridazin-2-yl)acetyl]amino]butanoic acid is sourced from PubChem (CID 43170711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).