C11H16N2O3S2 — CID 43171180
2-[methyl-[3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanoyl]amino]acetic acid (PubChem CID 43171180) has the molecular formula C11H16N2O3S2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-[methyl-[3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanoyl]amino]acetic acid.
| Compound Name | 2-[methyl-[3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 43171180 |
| Molecular Formula | C11H16N2O3S2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 2-[methyl-[3-[(2-methyl-1,3-thiazol-4-yl)methylsulfanyl]propanoyl]amino]acetic acid |
| SMILES | Cc1nc(CSCCC(=O)N(C)CC(=O)O)cs1 |
| InChI | InChI=1S/C11H16N2O3S2/c1-8-12-9(7-18-8)6-17-4-3-10(14)13(2)5-11(15)16/h7H,3-6H2,1-2H3,(H,15,16) |
| InChIKey | PEHXPYNLERSEDJ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|