C11H13NO4S — CID 43171583
3-hydroxy-2-[[(E)-3-(3-methylthiophen-2-yl)prop-2-enoyl]amino]propanoic acid (PubChem CID 43171583) has the molecular formula C11H13NO4S and a molecular weight of 255.29 g/mol. Its IUPAC name is 3-hydroxy-2-[[(E)-3-(3-methylthiophen-2-yl)prop-2-enoyl]amino]propanoic acid.
| Compound Name | 3-hydroxy-2-[[(E)-3-(3-methylthiophen-2-yl)prop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 43171583 |
| Molecular Formula | C11H13NO4S |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 3-hydroxy-2-[[(E)-3-(3-methylthiophen-2-yl)prop-2-enoyl]amino]propanoic acid |
| SMILES | Cc1ccsc1/C=C/C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C11H13NO4S/c1-7-4-5-17-9(7)2-3-10(14)12-8(6-13)11(15)16/h2-5,8,13H,6H2,1H3,(H,12,14)(H,15,16)/b3-2+ |
| InChIKey | KAGCXXIUTJTGKM-NSCUHMNNSA-N |
| XLogP | 0.63 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|