About 1-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]cyclohexane-1-carboxylic acid
1-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 43172037) has the molecular formula C13H17N3O5
and a molecular weight of 295.29 g/mol. Its IUPAC name is 1-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]cyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]cyclohexane-1-carboxylic acid |
| PubChem CID | 43172037 |
| Molecular Formula | C13H17N3O5 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 1-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(Cc1cc(=O)[nH]c(=O)[nH]1)NC1(C(=O)O)CCCCC1 |
| InChI | InChI=1S/C13H17N3O5/c17-9-6-8(14-12(21)15-9)7-10(18)16-13(11(19)20)4-2-1-3-5-13/h6H,1-5,7H2,(H,16,18)(H,19,20)(H2,14,15,17,21) |
| InChIKey | NPVHBAUJIGAUJI-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]cyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]cyclohexane-1-carboxylic acid?
The IUPAC name of 1-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]cyclohexane-1-carboxylic acid (CID 43172037) is 1-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]cyclohexane-1-carboxylic acid.
What is the SMILES notation for 1-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]cyclohexane-1-carboxylic acid?
The canonical SMILES for 1-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]cyclohexane-1-carboxylic acid is O=C(Cc1cc(=O)[nH]c(=O)[nH]1)NC1(C(=O)O)CCCCC1.
What is the InChIKey of 1-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]cyclohexane-1-carboxylic acid?
The InChIKey is NPVHBAUJIGAUJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O5/c17-9-6-8(14-12(21)15-9)7-10(18)16-13(11(19)20)4-2-1-3-5-13/h6H,1-5,7H2,(H,16,18)(H,19,20)(H2,14,15,17,21).
What are the key properties of 1-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]cyclohexane-1-carboxylic acid?
1-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]cyclohexane-1-carboxylic acid has a molecular weight of 295.29 g/mol, XLogP of -0.49, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]cyclohexane-1-carboxylic acid is sourced from PubChem (CID 43172037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).