About 7-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]heptanoic acid
7-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]heptanoic acid (PubChem CID 43172056) has the molecular formula C14H23N3O3
and a molecular weight of 281.36 g/mol. Its IUPAC name is 7-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]heptanoic acid.
Molecular Properties
| Compound Name | 7-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]heptanoic acid |
| PubChem CID | 43172056 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 7-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]heptanoic acid |
| SMILES | Cc1n[nH]c(C)c1CC(=O)NCCCCCCC(=O)O |
| InChI | InChI=1S/C14H23N3O3/c1-10-12(11(2)17-16-10)9-13(18)15-8-6-4-3-5-7-14(19)20/h3-9H2,1-2H3,(H,15,18)(H,16,17)(H,19,20) |
| InChIKey | LCFZOMOHDQFPDF-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]heptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]heptanoic acid?
The IUPAC name of 7-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]heptanoic acid (CID 43172056) is 7-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]heptanoic acid.
What is the SMILES notation for 7-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]heptanoic acid?
The canonical SMILES for 7-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]heptanoic acid is Cc1n[nH]c(C)c1CC(=O)NCCCCCCC(=O)O.
What is the InChIKey of 7-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]heptanoic acid?
The InChIKey is LCFZOMOHDQFPDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O3/c1-10-12(11(2)17-16-10)9-13(18)15-8-6-4-3-5-7-14(19)20/h3-9H2,1-2H3,(H,15,18)(H,16,17)(H,19,20).
What are the key properties of 7-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]heptanoic acid?
7-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]heptanoic acid has a molecular weight of 281.36 g/mol, XLogP of 1.72, 9 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[[2-(3,5-dimethyl-1H-pyrazol-4-yl)acetyl]amino]heptanoic acid is sourced from PubChem (CID 43172056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).