C24H24N2O6S — CID 4317210
[2-(3-nitroanilino)-2-oxoethyl] 3-(cyclohexylsulfanylmethyl)-1-benzofuran-2-carboxylate (PubChem CID 4317210) has the molecular formula C24H24N2O6S and a molecular weight of 468.53 g/mol. Its IUPAC name is [2-(3-nitroanilino)-2-oxoethyl] 3-(cyclohexylsulfanylmethyl)-1-benzofuran-2-carboxylate.
| Compound Name | [2-(3-nitroanilino)-2-oxoethyl] 3-(cyclohexylsulfanylmethyl)-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 4317210 |
| Molecular Formula | C24H24N2O6S |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | [2-(3-nitroanilino)-2-oxoethyl] 3-(cyclohexylsulfanylmethyl)-1-benzofuran-2-carboxylate |
| SMILES | O=C(COC(=O)c1oc2ccccc2c1CSC1CCCCC1)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H24N2O6S/c27-22(25-16-7-6-8-17(13-16)26(29)30)14-31-24(28)23-20(15-33-18-9-2-1-3-10-18)19-11-4-5-12-21(19)32-23/h4-8,11-13,18H,1-3,9-10,14-15H2,(H,25,27) |
| InChIKey | WZWKVTGRFMZPSW-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 111.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|