4-[methyl(3-methylsulfonylpropanoyl)amino]butanoic acid

C9H17NO5S — CID 43172390

IUPAC4-[methyl(3-methylsulfonylpropanoyl)amino]butanoic acid
SMILESCN(CCCC(=O)O)C(=O)CCS(C)(=O)=O
InChIInChI=1S/C9H17NO5S/c1-10(6-3-4-9(12)13)8(11)5-7-16(2,14)15/h3-7H2,1-2H3,(H,12,13)
InChIKeyPFOYWKXXCXTYSV-UHFFFAOYSA-N
MW251.30 g/mol
LogP-0.26
Rot. Bonds7

About 4-[methyl(3-methylsulfonylpropanoyl)amino]butanoic acid

4-[methyl(3-methylsulfonylpropanoyl)amino]butanoic acid (PubChem CID 43172390) has the molecular formula C9H17NO5S and a molecular weight of 251.30 g/mol. Its IUPAC name is 4-[methyl(3-methylsulfonylpropanoyl)amino]butanoic acid.

Molecular Properties

Compound Name4-[methyl(3-methylsulfonylpropanoyl)amino]butanoic acid
PubChem CID43172390
Molecular FormulaC9H17NO5S
Molecular Weight251.30 g/mol
Exact Mass251.08
IUPAC Name4-[methyl(3-methylsulfonylpropanoyl)amino]butanoic acid
SMILESCN(CCCC(=O)O)C(=O)CCS(C)(=O)=O
InChIInChI=1S/C9H17NO5S/c1-10(6-3-4-9(12)13)8(11)5-7-16(2,14)15/h3-7H2,1-2H3,(H,12,13)
InChIKeyPFOYWKXXCXTYSV-UHFFFAOYSA-N
XLogP-0.26
TPSA91.75 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.30
LogP ≤ 5-0.26
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 4-[methyl(3-methylsulfonylpropanoyl)amino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[methyl(3-methylsulfonylpropanoyl)amino]butanoic acid?
The IUPAC name of 4-[methyl(3-methylsulfonylpropanoyl)amino]butanoic acid (CID 43172390) is 4-[methyl(3-methylsulfonylpropanoyl)amino]butanoic acid.
What is the SMILES notation for 4-[methyl(3-methylsulfonylpropanoyl)amino]butanoic acid?
The canonical SMILES for 4-[methyl(3-methylsulfonylpropanoyl)amino]butanoic acid is CN(CCCC(=O)O)C(=O)CCS(C)(=O)=O.
What is the InChIKey of 4-[methyl(3-methylsulfonylpropanoyl)amino]butanoic acid?
The InChIKey is PFOYWKXXCXTYSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO5S/c1-10(6-3-4-9(12)13)8(11)5-7-16(2,14)15/h3-7H2,1-2H3,(H,12,13).
What are the key properties of 4-[methyl(3-methylsulfonylpropanoyl)amino]butanoic acid?
4-[methyl(3-methylsulfonylpropanoyl)amino]butanoic acid has a molecular weight of 251.30 g/mol, XLogP of -0.26, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[methyl(3-methylsulfonylpropanoyl)amino]butanoic acid is sourced from PubChem (CID 43172390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).