About 4-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]-methylamino]butanoic acid
4-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]-methylamino]butanoic acid (PubChem CID 43172433) has the molecular formula C11H15N3O5
and a molecular weight of 269.26 g/mol. Its IUPAC name is 4-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]-methylamino]butanoic acid.
Molecular Properties
| Compound Name | 4-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]-methylamino]butanoic acid |
| PubChem CID | 43172433 |
| Molecular Formula | C11H15N3O5 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 4-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]-methylamino]butanoic acid |
| SMILES | CN(CCCC(=O)O)C(=O)Cn1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C11H15N3O5/c1-13(5-2-3-10(17)18)9(16)7-14-6-4-8(15)12-11(14)19/h4,6H,2-3,5,7H2,1H3,(H,17,18)(H,12,15,19) |
| InChIKey | CYDVZJRIOVLFMN-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]-methylamino]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]-methylamino]butanoic acid?
The IUPAC name of 4-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]-methylamino]butanoic acid (CID 43172433) is 4-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]-methylamino]butanoic acid.
What is the SMILES notation for 4-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]-methylamino]butanoic acid?
The canonical SMILES for 4-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]-methylamino]butanoic acid is CN(CCCC(=O)O)C(=O)Cn1ccc(=O)[nH]c1=O.
What is the InChIKey of 4-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]-methylamino]butanoic acid?
The InChIKey is CYDVZJRIOVLFMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O5/c1-13(5-2-3-10(17)18)9(16)7-14-6-4-8(15)12-11(14)19/h4,6H,2-3,5,7H2,1H3,(H,17,18)(H,12,15,19).
What are the key properties of 4-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]-methylamino]butanoic acid?
4-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]-methylamino]butanoic acid has a molecular weight of 269.26 g/mol, XLogP of -1.14, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-(2,4-dioxopyrimidin-1-yl)acetyl]-methylamino]butanoic acid is sourced from PubChem (CID 43172433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).