C17H13FN4O4S — CID 4317308
2-[[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(2-methyl-3-nitrophenyl)acetamide (PubChem CID 4317308) has the molecular formula C17H13FN4O4S and a molecular weight of 388.38 g/mol. Its IUPAC name is 2-[[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(2-methyl-3-nitrophenyl)acetamide.
| Compound Name | 2-[[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(2-methyl-3-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 4317308 |
| Molecular Formula | C17H13FN4O4S |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 2-[[5-(3-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]-N-(2-methyl-3-nitrophenyl)acetamide |
| SMILES | Cc1c(NC(=O)CSc2nnc(-c3cccc(F)c3)o2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H13FN4O4S/c1-10-13(6-3-7-14(10)22(24)25)19-15(23)9-27-17-21-20-16(26-17)11-4-2-5-12(18)8-11/h2-8H,9H2,1H3,(H,19,23) |
| InChIKey | ZFQXJKJVTIEKGO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|