C11H14ClNO4S — CID 43173105
3-[(4-chlorophenyl)methyl-methylsulfamoyl]propanoic acid (PubChem CID 43173105) has the molecular formula C11H14ClNO4S and a molecular weight of 291.76 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methyl-methylsulfamoyl]propanoic acid.
| Compound Name | 3-[(4-chlorophenyl)methyl-methylsulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 43173105 |
| Molecular Formula | C11H14ClNO4S |
| Molecular Weight | 291.76 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 3-[(4-chlorophenyl)methyl-methylsulfamoyl]propanoic acid |
| SMILES | CN(Cc1ccc(Cl)cc1)S(=O)(=O)CCC(=O)O |
| InChI | InChI=1S/C11H14ClNO4S/c1-13(18(16,17)7-6-11(14)15)8-9-2-4-10(12)5-3-9/h2-5H,6-8H2,1H3,(H,14,15) |
| InChIKey | KDNYADAQUYDBSL-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.76 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |