About N-methyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide
N-methyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide (PubChem CID 43173134) has the molecular formula C5H7N3O4S
and a molecular weight of 205.19 g/mol. Its IUPAC name is N-methyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide.
Molecular Properties
| Compound Name | N-methyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide |
| PubChem CID | 43173134 |
| Molecular Formula | C5H7N3O4S |
| Molecular Weight | 205.19 g/mol |
| Exact Mass | 205.02 |
| IUPAC Name | N-methyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide |
| SMILES | CNS(=O)(=O)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C5H7N3O4S/c1-6-13(11,12)3-2-7-5(10)8-4(3)9/h2,6H,1H3,(H2,7,8,9,10) |
| InChIKey | PKIRXZLODYGLKC-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.19 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide?
The IUPAC name of N-methyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide (CID 43173134) is N-methyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide.
What is the SMILES notation for N-methyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide?
The canonical SMILES for N-methyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide is CNS(=O)(=O)c1c[nH]c(=O)[nH]c1=O.
What is the InChIKey of N-methyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide?
The InChIKey is PKIRXZLODYGLKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3O4S/c1-6-13(11,12)3-2-7-5(10)8-4(3)9/h2,6H,1H3,(H2,7,8,9,10).
What are the key properties of N-methyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide?
N-methyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide has a molecular weight of 205.19 g/mol, XLogP of -2.03, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2,4-dioxo-1H-pyrimidine-5-sulfonamide is sourced from PubChem (CID 43173134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).