C15H30F3N3 — CID 43173288
2-methyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]octan-1-amine (PubChem CID 43173288) has the molecular formula C15H30F3N3 and a molecular weight of 309.42 g/mol. Its IUPAC name is 2-methyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]octan-1-amine.
| Compound Name | 2-methyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]octan-1-amine |
|---|---|
| PubChem CID | 43173288 |
| Molecular Formula | C15H30F3N3 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.24 |
| IUPAC Name | 2-methyl-2-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]octan-1-amine |
| SMILES | CCCCCCC(C)(CN)N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C15H30F3N3/c1-3-4-5-6-7-14(2,12-19)21-10-8-20(9-11-21)13-15(16,17)18/h3-13,19H2,1-2H3 |
| InChIKey | RCJBXISTUIIPCD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|