About 5,5-dimethyl-2,3-diphenylmorpholine
5,5-dimethyl-2,3-diphenylmorpholine (PubChem CID 43174722) has the molecular formula C18H21NO
and a molecular weight of 267.37 g/mol. Its IUPAC name is 5,5-dimethyl-2,3-diphenylmorpholine.
Molecular Properties
| Compound Name | 5,5-dimethyl-2,3-diphenylmorpholine |
| PubChem CID | 43174722 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 5,5-dimethyl-2,3-diphenylmorpholine |
| SMILES | CC1(C)COC(c2ccccc2)C(c2ccccc2)N1 |
| InChI | InChI=1S/C18H21NO/c1-18(2)13-20-17(15-11-7-4-8-12-15)16(19-18)14-9-5-3-6-10-14/h3-12,16-17,19H,13H2,1-2H3 |
| InChIKey | ZHKKIXILAABIPQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,5-dimethyl-2,3-diphenylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-2,3-diphenylmorpholine?
The IUPAC name of 5,5-dimethyl-2,3-diphenylmorpholine (CID 43174722) is 5,5-dimethyl-2,3-diphenylmorpholine.
What is the SMILES notation for 5,5-dimethyl-2,3-diphenylmorpholine?
The canonical SMILES for 5,5-dimethyl-2,3-diphenylmorpholine is CC1(C)COC(c2ccccc2)C(c2ccccc2)N1.
What is the InChIKey of 5,5-dimethyl-2,3-diphenylmorpholine?
The InChIKey is ZHKKIXILAABIPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO/c1-18(2)13-20-17(15-11-7-4-8-12-15)16(19-18)14-9-5-3-6-10-14/h3-12,16-17,19H,13H2,1-2H3.
What are the key properties of 5,5-dimethyl-2,3-diphenylmorpholine?
5,5-dimethyl-2,3-diphenylmorpholine has a molecular weight of 267.37 g/mol, XLogP of 3.87, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-2,3-diphenylmorpholine is sourced from PubChem (CID 43174722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).