About 2-methyl-3-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxypropanimidamide
2-methyl-3-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxypropanimidamide (PubChem CID 43175291) has the molecular formula C14H15N3OS2
and a molecular weight of 305.43 g/mol. Its IUPAC name is 2-methyl-3-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxypropanimidamide.
Molecular Properties
| Compound Name | 2-methyl-3-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxypropanimidamide |
| PubChem CID | 43175291 |
| Molecular Formula | C14H15N3OS2 |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 2-methyl-3-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxypropanimidamide |
| SMILES | [H]/N=C(\N)C(C)COc1cc2sc(C)nc2c2sccc12 |
| InChI | InChI=1S/C14H15N3OS2/c1-7(14(15)16)6-18-10-5-11-12(17-8(2)20-11)13-9(10)3-4-19-13/h3-5,7H,6H2,1-2H3,(H3,15,16) |
| InChIKey | UFSQMZLGHKGCDC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 71.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxypropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxypropanimidamide?
The IUPAC name of 2-methyl-3-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxypropanimidamide (CID 43175291) is 2-methyl-3-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxypropanimidamide.
What is the SMILES notation for 2-methyl-3-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxypropanimidamide?
The canonical SMILES for 2-methyl-3-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxypropanimidamide is [H]/N=C(\N)C(C)COc1cc2sc(C)nc2c2sccc12.
What is the InChIKey of 2-methyl-3-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxypropanimidamide?
The InChIKey is UFSQMZLGHKGCDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3OS2/c1-7(14(15)16)6-18-10-5-11-12(17-8(2)20-11)13-9(10)3-4-19-13/h3-5,7H,6H2,1-2H3,(H3,15,16).
What are the key properties of 2-methyl-3-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxypropanimidamide?
2-methyl-3-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxypropanimidamide has a molecular weight of 305.43 g/mol, XLogP of 3.77, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxypropanimidamide is sourced from PubChem (CID 43175291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).