About 3-hexoxy-N'-hydroxypentanimidamide
3-hexoxy-N'-hydroxypentanimidamide (PubChem CID 43175332) has the molecular formula C11H24N2O2
and a molecular weight of 216.32 g/mol. Its IUPAC name is 3-hexoxy-N'-hydroxypentanimidamide.
Molecular Properties
| Compound Name | 3-hexoxy-N'-hydroxypentanimidamide |
| PubChem CID | 43175332 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | 3-hexoxy-N'-hydroxypentanimidamide |
| SMILES | CCCCCCOC(CC)C/C(N)=N/O |
| InChI | InChI=1S/C11H24N2O2/c1-3-5-6-7-8-15-10(4-2)9-11(12)13-14/h10,14H,3-9H2,1-2H3,(H2,12,13) |
| InChIKey | NKLDIPFFZJKQNW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-hexoxy-N'-hydroxypentanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hexoxy-N'-hydroxypentanimidamide?
The IUPAC name of 3-hexoxy-N'-hydroxypentanimidamide (CID 43175332) is 3-hexoxy-N'-hydroxypentanimidamide.
What is the SMILES notation for 3-hexoxy-N'-hydroxypentanimidamide?
The canonical SMILES for 3-hexoxy-N'-hydroxypentanimidamide is CCCCCCOC(CC)C/C(N)=N/O.
What is the InChIKey of 3-hexoxy-N'-hydroxypentanimidamide?
The InChIKey is NKLDIPFFZJKQNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2O2/c1-3-5-6-7-8-15-10(4-2)9-11(12)13-14/h10,14H,3-9H2,1-2H3,(H2,12,13).
What are the key properties of 3-hexoxy-N'-hydroxypentanimidamide?
3-hexoxy-N'-hydroxypentanimidamide has a molecular weight of 216.32 g/mol, XLogP of 2.50, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hexoxy-N'-hydroxypentanimidamide is sourced from PubChem (CID 43175332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).