C14H14N2O2S2 — CID 43175560
N-[2-(2-amino-2-sulfanylideneethoxy)phenyl]-3-methylthiophene-2-carboxamide (PubChem CID 43175560) has the molecular formula C14H14N2O2S2 and a molecular weight of 306.41 g/mol. Its IUPAC name is N-[2-(2-amino-2-sulfanylideneethoxy)phenyl]-3-methylthiophene-2-carboxamide.
| Compound Name | N-[2-(2-amino-2-sulfanylideneethoxy)phenyl]-3-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 43175560 |
| Molecular Formula | C14H14N2O2S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | N-[2-(2-amino-2-sulfanylideneethoxy)phenyl]-3-methylthiophene-2-carboxamide |
| SMILES | Cc1ccsc1C(=O)Nc1ccccc1OCC(N)=S |
| InChI | InChI=1S/C14H14N2O2S2/c1-9-6-7-20-13(9)14(17)16-10-4-2-3-5-11(10)18-8-12(15)19/h2-7H,8H2,1H3,(H2,15,19)(H,16,17) |
| InChIKey | ISYRZFSMTUSCQC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|