C14H11BrCl2N2 — CID 43175726
2-(4-bromo-2,6-dichlorophenyl)-1,3-dihydroisoindol-4-amine (PubChem CID 43175726) has the molecular formula C14H11BrCl2N2 and a molecular weight of 358.07 g/mol. Its IUPAC name is 2-(4-bromo-2,6-dichlorophenyl)-1,3-dihydroisoindol-4-amine.
| Compound Name | 2-(4-bromo-2,6-dichlorophenyl)-1,3-dihydroisoindol-4-amine |
|---|---|
| PubChem CID | 43175726 |
| Molecular Formula | C14H11BrCl2N2 |
| Molecular Weight | 358.07 g/mol |
| Exact Mass | 355.95 |
| IUPAC Name | 2-(4-bromo-2,6-dichlorophenyl)-1,3-dihydroisoindol-4-amine |
| SMILES | Nc1cccc2c1CN(c1c(Cl)cc(Br)cc1Cl)C2 |
| InChI | InChI=1S/C14H11BrCl2N2/c15-9-4-11(16)14(12(17)5-9)19-6-8-2-1-3-13(18)10(8)7-19/h1-5H,6-7,18H2 |
| InChIKey | VUWGHKXIYFGDEL-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.07 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|