About 6-methylheptan-3-amine
6-methylheptan-3-amine (PubChem CID 43175892) has the molecular formula C8H19N
and a molecular weight of 129.25 g/mol. Its IUPAC name is 6-methylheptan-3-amine.
Molecular Properties
| Compound Name | 6-methylheptan-3-amine |
| PubChem CID | 43175892 |
| Molecular Formula | C8H19N |
| Molecular Weight | 129.25 g/mol |
| Exact Mass | 129.15 |
| IUPAC Name | 6-methylheptan-3-amine |
| SMILES | CCC(N)CCC(C)C |
| InChI | InChI=1S/C8H19N/c1-4-8(9)6-5-7(2)3/h7-8H,4-6,9H2,1-3H3 |
| InChIKey | VYNGSWRPKZBLTN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.25 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-methylheptan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylheptan-3-amine?
The IUPAC name of 6-methylheptan-3-amine (CID 43175892) is 6-methylheptan-3-amine.
What is the SMILES notation for 6-methylheptan-3-amine?
The canonical SMILES for 6-methylheptan-3-amine is CCC(N)CCC(C)C.
What is the InChIKey of 6-methylheptan-3-amine?
The InChIKey is VYNGSWRPKZBLTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N/c1-4-8(9)6-5-7(2)3/h7-8H,4-6,9H2,1-3H3.
What are the key properties of 6-methylheptan-3-amine?
6-methylheptan-3-amine has a molecular weight of 129.25 g/mol, XLogP of 2.16, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylheptan-3-amine is sourced from PubChem (CID 43175892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).