About [4-tert-butyl-1-(2,6-dimethylmorpholin-4-yl)cyclohexyl]methanamine
[4-tert-butyl-1-(2,6-dimethylmorpholin-4-yl)cyclohexyl]methanamine (PubChem CID 43176290) has the molecular formula C17H34N2O
and a molecular weight of 282.47 g/mol. Its IUPAC name is [4-tert-butyl-1-(2,6-dimethylmorpholin-4-yl)cyclohexyl]methanamine.
Molecular Properties
| Compound Name | [4-tert-butyl-1-(2,6-dimethylmorpholin-4-yl)cyclohexyl]methanamine |
| PubChem CID | 43176290 |
| Molecular Formula | C17H34N2O |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | [4-tert-butyl-1-(2,6-dimethylmorpholin-4-yl)cyclohexyl]methanamine |
| SMILES | CC1CN(C2(CN)CCC(C(C)(C)C)CC2)CC(C)O1 |
| InChI | InChI=1S/C17H34N2O/c1-13-10-19(11-14(2)20-13)17(12-18)8-6-15(7-9-17)16(3,4)5/h13-15H,6-12,18H2,1-5H3 |
| InChIKey | ASVPIOFZBIQEHN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-tert-butyl-1-(2,6-dimethylmorpholin-4-yl)cyclohexyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-tert-butyl-1-(2,6-dimethylmorpholin-4-yl)cyclohexyl]methanamine?
The IUPAC name of [4-tert-butyl-1-(2,6-dimethylmorpholin-4-yl)cyclohexyl]methanamine (CID 43176290) is [4-tert-butyl-1-(2,6-dimethylmorpholin-4-yl)cyclohexyl]methanamine.
What is the SMILES notation for [4-tert-butyl-1-(2,6-dimethylmorpholin-4-yl)cyclohexyl]methanamine?
The canonical SMILES for [4-tert-butyl-1-(2,6-dimethylmorpholin-4-yl)cyclohexyl]methanamine is CC1CN(C2(CN)CCC(C(C)(C)C)CC2)CC(C)O1.
What is the InChIKey of [4-tert-butyl-1-(2,6-dimethylmorpholin-4-yl)cyclohexyl]methanamine?
The InChIKey is ASVPIOFZBIQEHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34N2O/c1-13-10-19(11-14(2)20-13)17(12-18)8-6-15(7-9-17)16(3,4)5/h13-15H,6-12,18H2,1-5H3.
What are the key properties of [4-tert-butyl-1-(2,6-dimethylmorpholin-4-yl)cyclohexyl]methanamine?
[4-tert-butyl-1-(2,6-dimethylmorpholin-4-yl)cyclohexyl]methanamine has a molecular weight of 282.47 g/mol, XLogP of 3.03, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-tert-butyl-1-(2,6-dimethylmorpholin-4-yl)cyclohexyl]methanamine is sourced from PubChem (CID 43176290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).